About 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-6-(trifluoromethyl)pyridine-4-carbonitrile
2-[(2Z)-2-ethenylpenta-2,4-dienyl]-6-(trifluoromethyl)pyridine-4-carbonitrile (PubChem CID 142302084) has the molecular formula C14H11F3N2
and a molecular weight of 264.25 g/mol. Its IUPAC name is 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-6-(trifluoromethyl)pyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-6-(trifluoromethyl)pyridine-4-carbonitrile |
| PubChem CID | 142302084 |
| Molecular Formula | C14H11F3N2 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-6-(trifluoromethyl)pyridine-4-carbonitrile |
| SMILES | C=C/C=C(\C=C)Cc1cc(C#N)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H11F3N2/c1-3-5-10(4-2)6-12-7-11(9-18)8-13(19-12)14(15,16)17/h3-5,7-8H,1-2,6H2/b10-5+ |
| InChIKey | VRPLEAZYXMKBCR-BJMVGYQFSA-N |
| XLogP | 3.81 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-6-(trifluoromethyl)pyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-6-(trifluoromethyl)pyridine-4-carbonitrile?
The IUPAC name of 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-6-(trifluoromethyl)pyridine-4-carbonitrile (CID 142302084) is 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-6-(trifluoromethyl)pyridine-4-carbonitrile.
What is the SMILES notation for 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-6-(trifluoromethyl)pyridine-4-carbonitrile?
The canonical SMILES for 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-6-(trifluoromethyl)pyridine-4-carbonitrile is C=C/C=C(\C=C)Cc1cc(C#N)cc(C(F)(F)F)n1.
What is the InChIKey of 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-6-(trifluoromethyl)pyridine-4-carbonitrile?
The InChIKey is VRPLEAZYXMKBCR-BJMVGYQFSA-N. The full InChI is InChI=1S/C14H11F3N2/c1-3-5-10(4-2)6-12-7-11(9-18)8-13(19-12)14(15,16)17/h3-5,7-8H,1-2,6H2/b10-5+.
What are the key properties of 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-6-(trifluoromethyl)pyridine-4-carbonitrile?
2-[(2Z)-2-ethenylpenta-2,4-dienyl]-6-(trifluoromethyl)pyridine-4-carbonitrile has a molecular weight of 264.25 g/mol, XLogP of 3.81, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-6-(trifluoromethyl)pyridine-4-carbonitrile is sourced from PubChem (CID 142302084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).