C27H35N7O — CID 142302625
N-diazenyl-N-[2-[4-[2-(2,6-dimethyl-4-pyridinyl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]-2-oxoethyl]ethanimidamide (PubChem CID 142302625) has the molecular formula C27H35N7O and a molecular weight of 473.63 g/mol. Its IUPAC name is N-diazenyl-N-[2-[4-[2-(2,6-dimethyl-4-pyridinyl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]-2-oxoethyl]ethanimidamide.
| Compound Name | N-diazenyl-N-[2-[4-[2-(2,6-dimethyl-4-pyridinyl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]-2-oxoethyl]ethanimidamide |
|---|---|
| PubChem CID | 142302625 |
| Molecular Formula | C27H35N7O |
| Molecular Weight | 473.63 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | N-diazenyl-N-[2-[4-[2-(2,6-dimethyl-4-pyridinyl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]-2-oxoethyl]ethanimidamide |
| SMILES | [H]/N=N/N(CC(=O)N1CCC(c2ccc3[nH]c(-c4cc(C)nc(C)c4)c(C(C)C)c3c2)CC1)/C(C)=N/[H] |
| InChI | InChI=1S/C27H35N7O/c1-16(2)26-23-14-21(6-7-24(23)31-27(26)22-12-17(3)30-18(4)13-22)20-8-10-33(11-9-20)25(35)15-34(32-29)19(5)28/h6-7,12-14,16,20,28-29,31H,8-11,15H2,1-5H3/b28-19+,32-29+ |
| InChIKey | JAADRGUMHFZNMS-FVAAQFFJSA-N |
| XLogP | 5.92 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.63 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|