C20H35NS — CID 142304073
(3E,6E,7E)-5-ethylidene-8-ethylsulfanyl-N,2,4-trimethyl-6-propylidenedeca-3,7-dien-3-amine (PubChem CID 142304073) has the molecular formula C20H35NS and a molecular weight of 321.57 g/mol. Its IUPAC name is (3E,6E,7E)-5-ethylidene-8-ethylsulfanyl-N,2,4-trimethyl-6-propylidenedeca-3,7-dien-3-amine.
| Compound Name | (3E,6E,7E)-5-ethylidene-8-ethylsulfanyl-N,2,4-trimethyl-6-propylidenedeca-3,7-dien-3-amine |
|---|---|
| PubChem CID | 142304073 |
| Molecular Formula | C20H35NS |
| Molecular Weight | 321.57 g/mol |
| Exact Mass | 321.25 |
| IUPAC Name | (3E,6E,7E)-5-ethylidene-8-ethylsulfanyl-N,2,4-trimethyl-6-propylidenedeca-3,7-dien-3-amine |
| SMILES | CC=C(C(/C=C(\CC)SCC)=C/CC)/C(C)=C(/NC)C(C)C |
| InChI | InChI=1S/C20H35NS/c1-9-13-17(14-18(10-2)22-12-4)19(11-3)16(7)20(21-8)15(5)6/h11,13-15,21H,9-10,12H2,1-8H3/b17-13+,18-14+,19-11?,20-16+ |
| InChIKey | LDLQIDZSZKKSFB-JIBOERBPSA-N |
| XLogP | 6.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.57 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|