C12H16N6O2S — CID 142305336
acetamide;N-cyclopropylsulfanyl-1-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)methanamine (PubChem CID 142305336) has the molecular formula C12H16N6O2S and a molecular weight of 308.37 g/mol. Its IUPAC name is acetamide;N-cyclopropylsulfanyl-1-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)methanamine.
| Compound Name | acetamide;N-cyclopropylsulfanyl-1-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)methanamine |
|---|---|
| PubChem CID | 142305336 |
| Molecular Formula | C12H16N6O2S |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | acetamide;N-cyclopropylsulfanyl-1-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)methanamine |
| SMILES | CC(N)=O.c1cnc(-c2noc(CNSC3CC3)n2)cn1 |
| InChI | InChI=1S/C10H11N5OS.C2H5NO/c1-2-7(1)17-13-6-9-14-10(15-16-9)8-5-11-3-4-12-8;1-2(3)4/h3-5,7,13H,1-2,6H2;1H3,(H2,3,4) |
| InChIKey | DZIZDWPHUMYKPT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 119.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|