About [(2R,3R)-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl methanesulfonate
[(2R,3R)-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl methanesulfonate (PubChem CID 14230537) has the molecular formula C13H16N2O6S
and a molecular weight of 328.35 g/mol. Its IUPAC name is [(2R,3R)-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl methanesulfonate.
Molecular Properties
| Compound Name | [(2R,3R)-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl methanesulfonate |
| PubChem CID | 14230537 |
| Molecular Formula | C13H16N2O6S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | [(2R,3R)-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@@H]1NC(=O)[C@@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H16N2O6S/c1-22(18,19)21-8-10-11(12(16)14-10)15-13(17)20-7-9-5-3-2-4-6-9/h2-6,10-11H,7-8H2,1H3,(H,14,16)(H,15,17)/t10-,11+/m0/s1 |
| InChIKey | BSVQFTVZQOJHBD-WDEREUQCSA-N |
| XLogP | -0.24 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(2R,3R)-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R)-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl methanesulfonate?
The IUPAC name of [(2R,3R)-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl methanesulfonate (CID 14230537) is [(2R,3R)-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl methanesulfonate.
What is the SMILES notation for [(2R,3R)-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl methanesulfonate?
The canonical SMILES for [(2R,3R)-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl methanesulfonate is CS(=O)(=O)OC[C@@H]1NC(=O)[C@@H]1NC(=O)OCc1ccccc1.
What is the InChIKey of [(2R,3R)-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl methanesulfonate?
The InChIKey is BSVQFTVZQOJHBD-WDEREUQCSA-N. The full InChI is InChI=1S/C13H16N2O6S/c1-22(18,19)21-8-10-11(12(16)14-10)15-13(17)20-7-9-5-3-2-4-6-9/h2-6,10-11H,7-8H2,1H3,(H,14,16)(H,15,17)/t10-,11+/m0/s1.
What are the key properties of [(2R,3R)-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl methanesulfonate?
[(2R,3R)-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl methanesulfonate has a molecular weight of 328.35 g/mol, XLogP of -0.24, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R)-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl methanesulfonate is sourced from PubChem (CID 14230537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).