C13H23NO — CID 142305880
(2E,4Z)-N-cyclopropyl-2-ethylhexa-2,4-dienamide;ethane (PubChem CID 142305880) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (2E,4Z)-N-cyclopropyl-2-ethylhexa-2,4-dienamide;ethane.
| Compound Name | (2E,4Z)-N-cyclopropyl-2-ethylhexa-2,4-dienamide;ethane |
|---|---|
| PubChem CID | 142305880 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (2E,4Z)-N-cyclopropyl-2-ethylhexa-2,4-dienamide;ethane |
| SMILES | C/C=C\C=C(/CC)C(=O)NC1CC1.CC |
| InChI | InChI=1S/C11H17NO.C2H6/c1-3-5-6-9(4-2)11(13)12-10-7-8-10;1-2/h3,5-6,10H,4,7-8H2,1-2H3,(H,12,13);1-2H3/b5-3-,9-6+; |
| InChIKey | QNIGUJQSYMFITO-XRVNEYCPSA-N |
| XLogP | 3.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|