C15H17FN2O4 — CID 142305954
(2E)-N-(2,6-dioxopiperidin-3-yl)-2-(1-fluoroethenyl)-3-formyl-N,4-dimethylpenta-2,4-dienamide (PubChem CID 142305954) has the molecular formula C15H17FN2O4 and a molecular weight of 308.31 g/mol. Its IUPAC name is (2E)-N-(2,6-dioxopiperidin-3-yl)-2-(1-fluoroethenyl)-3-formyl-N,4-dimethylpenta-2,4-dienamide.
| Compound Name | (2E)-N-(2,6-dioxopiperidin-3-yl)-2-(1-fluoroethenyl)-3-formyl-N,4-dimethylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 142305954 |
| Molecular Formula | C15H17FN2O4 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (2E)-N-(2,6-dioxopiperidin-3-yl)-2-(1-fluoroethenyl)-3-formyl-N,4-dimethylpenta-2,4-dienamide |
| SMILES | C=C(C)/C(C=O)=C(\C(=C)F)C(=O)N(C)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C15H17FN2O4/c1-8(2)10(7-19)13(9(3)16)15(22)18(4)11-5-6-12(20)17-14(11)21/h7,11H,1,3,5-6H2,2,4H3,(H,17,20,21)/b13-10+ |
| InChIKey | FJQGETAKOPPAQV-JLHYYAGUSA-N |
| XLogP | 0.80 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|