About 4-methoxy-N,N-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine
4-methoxy-N,N-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine (PubChem CID 142305976) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is 4-methoxy-N,N-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine.
Molecular Properties
| Compound Name | 4-methoxy-N,N-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine |
| PubChem CID | 142305976 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 4-methoxy-N,N-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine |
| SMILES | COC1=CC2CC2C=C1N(C)C |
| InChI | InChI=1S/C10H15NO/c1-11(2)9-5-7-4-8(7)6-10(9)12-3/h5-8H,4H2,1-3H3 |
| InChIKey | ZODZEMXJLSBJSP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methoxy-N,N-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-N,N-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine?
The IUPAC name of 4-methoxy-N,N-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine (CID 142305976) is 4-methoxy-N,N-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine.
What is the SMILES notation for 4-methoxy-N,N-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine?
The canonical SMILES for 4-methoxy-N,N-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine is COC1=CC2CC2C=C1N(C)C.
What is the InChIKey of 4-methoxy-N,N-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine?
The InChIKey is ZODZEMXJLSBJSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c1-11(2)9-5-7-4-8(7)6-10(9)12-3/h5-8H,4H2,1-3H3.
What are the key properties of 4-methoxy-N,N-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine?
4-methoxy-N,N-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine has a molecular weight of 165.24 g/mol, XLogP of 1.61, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-N,N-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine is sourced from PubChem (CID 142305976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).