C29H29ClN6S — CID 142306048
(9S)-7-(4-chlorophenyl)-4-[2-[1-(cyclohexylmethyl)pyrazol-4-yl]ethynyl]-5,9,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 142306048) has the molecular formula C29H29ClN6S and a molecular weight of 529.11 g/mol. Its IUPAC name is (9S)-7-(4-chlorophenyl)-4-[2-[1-(cyclohexylmethyl)pyrazol-4-yl]ethynyl]-5,9,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | (9S)-7-(4-chlorophenyl)-4-[2-[1-(cyclohexylmethyl)pyrazol-4-yl]ethynyl]-5,9,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 142306048 |
| Molecular Formula | C29H29ClN6S |
| Molecular Weight | 529.11 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | (9S)-7-(4-chlorophenyl)-4-[2-[1-(cyclohexylmethyl)pyrazol-4-yl]ethynyl]-5,9,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | Cc1c(C#Cc2cnn(CC3CCCCC3)c2)sc2c1C(c1ccc(Cl)cc1)=N[C@@H](C)c1nnc(C)n1-2 |
| InChI | InChI=1S/C29H29ClN6S/c1-18-25(14-9-22-15-31-35(17-22)16-21-7-5-4-6-8-21)37-29-26(18)27(23-10-12-24(30)13-11-23)32-19(2)28-34-33-20(3)36(28)29/h10-13,15,17,19,21H,4-8,16H2,1-3H3/t19-/m0/s1 |
| InChIKey | ABCPIVBMBZQKRI-IBGZPJMESA-N |
| XLogP | 6.69 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.11 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|