C24H20FN5O4S2 — CID 142306350
(6aR)-N-[[2-(4-cyano-2-fluorophenyl)-1,3-thiazol-5-yl]methyl]-6,12,12-trioxo-5,6a,7,8,9,10-hexahydropyrido[1,2-b][1,2,5]benzothiadiazepine-3-carboxamide (PubChem CID 142306350) has the molecular formula C24H20FN5O4S2 and a molecular weight of 525.59 g/mol. Its IUPAC name is (6aR)-N-[[2-(4-cyano-2-fluorophenyl)-1,3-thiazol-5-yl]methyl]-6,12,12-trioxo-5,6a,7,8,9,10-hexahydropyrido[1,2-b][1,2,5]benzothiadiazepine-3-carboxamide.
| Compound Name | (6aR)-N-[[2-(4-cyano-2-fluorophenyl)-1,3-thiazol-5-yl]methyl]-6,12,12-trioxo-5,6a,7,8,9,10-hexahydropyrido[1,2-b][1,2,5]benzothiadiazepine-3-carboxamide |
|---|---|
| PubChem CID | 142306350 |
| Molecular Formula | C24H20FN5O4S2 |
| Molecular Weight | 525.59 g/mol |
| Exact Mass | 525.09 |
| IUPAC Name | (6aR)-N-[[2-(4-cyano-2-fluorophenyl)-1,3-thiazol-5-yl]methyl]-6,12,12-trioxo-5,6a,7,8,9,10-hexahydropyrido[1,2-b][1,2,5]benzothiadiazepine-3-carboxamide |
| SMILES | N#Cc1ccc(-c2ncc(CNC(=O)c3ccc4c(c3)NC(=O)[C@H]3CCCCN3S4(=O)=O)s2)c(F)c1 |
| InChI | InChI=1S/C24H20FN5O4S2/c25-18-9-14(11-26)4-6-17(18)24-28-13-16(35-24)12-27-22(31)15-5-7-21-19(10-15)29-23(32)20-3-1-2-8-30(20)36(21,33)34/h4-7,9-10,13,20H,1-3,8,12H2,(H,27,31)(H,29,32)/t20-/m1/s1 |
| InChIKey | BAZZHBFGCMABIY-HXUWFJFHSA-N |
| XLogP | 3.25 |
| TPSA | 132.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.59 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |