About 4-cyclopropyl-2-ethyl-3,5-dimethylpyridine;ethane
4-cyclopropyl-2-ethyl-3,5-dimethylpyridine;ethane (PubChem CID 142306392) has the molecular formula C16H29N
and a molecular weight of 235.41 g/mol. Its IUPAC name is 4-cyclopropyl-2-ethyl-3,5-dimethylpyridine;ethane.
Molecular Properties
| Compound Name | 4-cyclopropyl-2-ethyl-3,5-dimethylpyridine;ethane |
| PubChem CID | 142306392 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | 4-cyclopropyl-2-ethyl-3,5-dimethylpyridine;ethane |
| SMILES | CC.CC.CCc1ncc(C)c(C2CC2)c1C |
| InChI | InChI=1S/C12H17N.2C2H6/c1-4-11-9(3)12(10-5-6-10)8(2)7-13-11;2*1-2/h7,10H,4-6H2,1-3H3;2*1-2H3 |
| InChIKey | BGVXUXZZLSIVEV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-cyclopropyl-2-ethyl-3,5-dimethylpyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-2-ethyl-3,5-dimethylpyridine;ethane?
The IUPAC name of 4-cyclopropyl-2-ethyl-3,5-dimethylpyridine;ethane (CID 142306392) is 4-cyclopropyl-2-ethyl-3,5-dimethylpyridine;ethane.
What is the SMILES notation for 4-cyclopropyl-2-ethyl-3,5-dimethylpyridine;ethane?
The canonical SMILES for 4-cyclopropyl-2-ethyl-3,5-dimethylpyridine;ethane is CC.CC.CCc1ncc(C)c(C2CC2)c1C.
What is the InChIKey of 4-cyclopropyl-2-ethyl-3,5-dimethylpyridine;ethane?
The InChIKey is BGVXUXZZLSIVEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N.2C2H6/c1-4-11-9(3)12(10-5-6-10)8(2)7-13-11;2*1-2/h7,10H,4-6H2,1-3H3;2*1-2H3.
What are the key properties of 4-cyclopropyl-2-ethyl-3,5-dimethylpyridine;ethane?
4-cyclopropyl-2-ethyl-3,5-dimethylpyridine;ethane has a molecular weight of 235.41 g/mol, XLogP of 5.19, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-2-ethyl-3,5-dimethylpyridine;ethane is sourced from PubChem (CID 142306392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).