About 2-chloro-N-(8-hydroxyoctyl)acetamide;ethane
2-chloro-N-(8-hydroxyoctyl)acetamide;ethane (PubChem CID 142307280) has the molecular formula C12H26ClNO2
and a molecular weight of 251.80 g/mol. Its IUPAC name is 2-chloro-N-(8-hydroxyoctyl)acetamide;ethane.
Molecular Properties
| Compound Name | 2-chloro-N-(8-hydroxyoctyl)acetamide;ethane |
| PubChem CID | 142307280 |
| Molecular Formula | C12H26ClNO2 |
| Molecular Weight | 251.80 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 2-chloro-N-(8-hydroxyoctyl)acetamide;ethane |
| SMILES | CC.O=C(CCl)NCCCCCCCCO |
| InChI | InChI=1S/C10H20ClNO2.C2H6/c11-9-10(14)12-7-5-3-1-2-4-6-8-13;1-2/h13H,1-9H2,(H,12,14);1-2H3 |
| InChIKey | ATTUUTRKLYFIBF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.80 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-(8-hydroxyoctyl)acetamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(8-hydroxyoctyl)acetamide;ethane?
The IUPAC name of 2-chloro-N-(8-hydroxyoctyl)acetamide;ethane (CID 142307280) is 2-chloro-N-(8-hydroxyoctyl)acetamide;ethane.
What is the SMILES notation for 2-chloro-N-(8-hydroxyoctyl)acetamide;ethane?
The canonical SMILES for 2-chloro-N-(8-hydroxyoctyl)acetamide;ethane is CC.O=C(CCl)NCCCCCCCCO.
What is the InChIKey of 2-chloro-N-(8-hydroxyoctyl)acetamide;ethane?
The InChIKey is ATTUUTRKLYFIBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20ClNO2.C2H6/c11-9-10(14)12-7-5-3-1-2-4-6-8-13;1-2/h13H,1-9H2,(H,12,14);1-2H3.
What are the key properties of 2-chloro-N-(8-hydroxyoctyl)acetamide;ethane?
2-chloro-N-(8-hydroxyoctyl)acetamide;ethane has a molecular weight of 251.80 g/mol, XLogP of 2.70, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(8-hydroxyoctyl)acetamide;ethane is sourced from PubChem (CID 142307280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).