C14H17NO2 — CID 142307384
2-[(8aS)-7-(hydroxymethyl)-8a-methyl-1-oxo-3a,4,5,8-tetrahydroazulen-4-yl]acetonitrile (PubChem CID 142307384) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is 2-[(8aS)-7-(hydroxymethyl)-8a-methyl-1-oxo-3a,4,5,8-tetrahydroazulen-4-yl]acetonitrile.
| Compound Name | 2-[(8aS)-7-(hydroxymethyl)-8a-methyl-1-oxo-3a,4,5,8-tetrahydroazulen-4-yl]acetonitrile |
|---|---|
| PubChem CID | 142307384 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 2-[(8aS)-7-(hydroxymethyl)-8a-methyl-1-oxo-3a,4,5,8-tetrahydroazulen-4-yl]acetonitrile |
| SMILES | C[C@]12CC(CO)=CCC(CC#N)C1C=CC2=O |
| InChI | InChI=1S/C14H17NO2/c1-14-8-10(9-16)2-3-11(6-7-15)12(14)4-5-13(14)17/h2,4-5,11-12,16H,3,6,8-9H2,1H3/t11?,12?,14-/m0/s1 |
| InChIKey | DXDLGHCEJNUCQX-YIZWMMSDSA-N |
| XLogP | 1.99 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|