C19H23N5O4S2 — CID 142307425
S-[[[(2S,4S,5S)-1-acetyl-2-acetylsulfanyl-4-cyano-4-methyl-5-pyrimidin-5-ylpyrrolidine-2-carbonyl]-methylamino]methyl] ethanethioate (PubChem CID 142307425) has the molecular formula C19H23N5O4S2 and a molecular weight of 449.56 g/mol. Its IUPAC name is S-[[[(2S,4S,5S)-1-acetyl-2-acetylsulfanyl-4-cyano-4-methyl-5-pyrimidin-5-ylpyrrolidine-2-carbonyl]-methylamino]methyl] ethanethioate.
| Compound Name | S-[[[(2S,4S,5S)-1-acetyl-2-acetylsulfanyl-4-cyano-4-methyl-5-pyrimidin-5-ylpyrrolidine-2-carbonyl]-methylamino]methyl] ethanethioate |
|---|---|
| PubChem CID | 142307425 |
| Molecular Formula | C19H23N5O4S2 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | S-[[[(2S,4S,5S)-1-acetyl-2-acetylsulfanyl-4-cyano-4-methyl-5-pyrimidin-5-ylpyrrolidine-2-carbonyl]-methylamino]methyl] ethanethioate |
| SMILES | CC(=O)SCN(C)C(=O)[C@@]1(SC(C)=O)C[C@](C)(C#N)[C@H](c2cncnc2)N1C(C)=O |
| InChI | InChI=1S/C19H23N5O4S2/c1-12(25)24-16(15-6-21-10-22-7-15)18(4,9-20)8-19(24,30-14(3)27)17(28)23(5)11-29-13(2)26/h6-7,10,16H,8,11H2,1-5H3/t16-,18+,19-/m0/s1 |
| InChIKey | ZRIGGUZLCDIHCY-UHOSZYNNSA-N |
| XLogP | 1.97 |
| TPSA | 124.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|