About tert-butyl N-[6-[(2,6-dimethyl-4-pyridinyl)oxymethyl]-5-(propanoylamino)hept-6-enyl]carbamate
tert-butyl N-[6-[(2,6-dimethyl-4-pyridinyl)oxymethyl]-5-(propanoylamino)hept-6-enyl]carbamate (PubChem CID 142307579) has the molecular formula C23H37N3O4
and a molecular weight of 419.57 g/mol. Its IUPAC name is tert-butyl N-[6-[(2,6-dimethyl-4-pyridinyl)oxymethyl]-5-(propanoylamino)hept-6-enyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[6-[(2,6-dimethyl-4-pyridinyl)oxymethyl]-5-(propanoylamino)hept-6-enyl]carbamate |
| PubChem CID | 142307579 |
| Molecular Formula | C23H37N3O4 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | tert-butyl N-[6-[(2,6-dimethyl-4-pyridinyl)oxymethyl]-5-(propanoylamino)hept-6-enyl]carbamate |
| SMILES | C=C(COc1cc(C)nc(C)c1)C(CCCCNC(=O)OC(C)(C)C)NC(=O)CC |
| InChI | InChI=1S/C23H37N3O4/c1-8-21(27)26-20(11-9-10-12-24-22(28)30-23(5,6)7)16(2)15-29-19-13-17(3)25-18(4)14-19/h13-14,20H,2,8-12,15H2,1,3-7H3,(H,24,28)(H,26,27) |
| InChIKey | FGUHMLUGRSBXQD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[6-[(2,6-dimethyl-4-pyridinyl)oxymethyl]-5-(propanoylamino)hept-6-enyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[6-[(2,6-dimethyl-4-pyridinyl)oxymethyl]-5-(propanoylamino)hept-6-enyl]carbamate?
The IUPAC name of tert-butyl N-[6-[(2,6-dimethyl-4-pyridinyl)oxymethyl]-5-(propanoylamino)hept-6-enyl]carbamate (CID 142307579) is tert-butyl N-[6-[(2,6-dimethyl-4-pyridinyl)oxymethyl]-5-(propanoylamino)hept-6-enyl]carbamate.
What is the SMILES notation for tert-butyl N-[6-[(2,6-dimethyl-4-pyridinyl)oxymethyl]-5-(propanoylamino)hept-6-enyl]carbamate?
The canonical SMILES for tert-butyl N-[6-[(2,6-dimethyl-4-pyridinyl)oxymethyl]-5-(propanoylamino)hept-6-enyl]carbamate is C=C(COc1cc(C)nc(C)c1)C(CCCCNC(=O)OC(C)(C)C)NC(=O)CC.
What is the InChIKey of tert-butyl N-[6-[(2,6-dimethyl-4-pyridinyl)oxymethyl]-5-(propanoylamino)hept-6-enyl]carbamate?
The InChIKey is FGUHMLUGRSBXQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H37N3O4/c1-8-21(27)26-20(11-9-10-12-24-22(28)30-23(5,6)7)16(2)15-29-19-13-17(3)25-18(4)14-19/h13-14,20H,2,8-12,15H2,1,3-7H3,(H,24,28)(H,26,27).
What are the key properties of tert-butyl N-[6-[(2,6-dimethyl-4-pyridinyl)oxymethyl]-5-(propanoylamino)hept-6-enyl]carbamate?
tert-butyl N-[6-[(2,6-dimethyl-4-pyridinyl)oxymethyl]-5-(propanoylamino)hept-6-enyl]carbamate has a molecular weight of 419.57 g/mol, XLogP of 4.22, 11 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[6-[(2,6-dimethyl-4-pyridinyl)oxymethyl]-5-(propanoylamino)hept-6-enyl]carbamate is sourced from PubChem (CID 142307579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).