About ethyl-[(Z)-4,4,4-trifluoro-3-iminobut-1-enyl]azanium
ethyl-[(Z)-4,4,4-trifluoro-3-iminobut-1-enyl]azanium (PubChem CID 142308476) has the molecular formula C6H10F3N2+
and a molecular weight of 167.15 g/mol. Its IUPAC name is ethyl-[(Z)-4,4,4-trifluoro-3-iminobut-1-enyl]azanium.
Molecular Properties
| Compound Name | ethyl-[(Z)-4,4,4-trifluoro-3-iminobut-1-enyl]azanium |
| PubChem CID | 142308476 |
| Molecular Formula | C6H10F3N2+ |
| Molecular Weight | 167.15 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | ethyl-[(Z)-4,4,4-trifluoro-3-iminobut-1-enyl]azanium |
| SMILES | [H]/N=C(\C=C/[NH2+]CC)C(F)(F)F |
| InChI | InChI=1S/C6H9F3N2/c1-2-11-4-3-5(10)6(7,8)9/h3-4,10-11H,2H2,1H3/p+1/b4-3-,10-5+ |
| InChIKey | YOURFAFNCQOPQB-DXWLQBKVSA-O |
| XLogP | 0.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.15 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl-[(Z)-4,4,4-trifluoro-3-iminobut-1-enyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl-[(Z)-4,4,4-trifluoro-3-iminobut-1-enyl]azanium?
The IUPAC name of ethyl-[(Z)-4,4,4-trifluoro-3-iminobut-1-enyl]azanium (CID 142308476) is ethyl-[(Z)-4,4,4-trifluoro-3-iminobut-1-enyl]azanium.
What is the SMILES notation for ethyl-[(Z)-4,4,4-trifluoro-3-iminobut-1-enyl]azanium?
The canonical SMILES for ethyl-[(Z)-4,4,4-trifluoro-3-iminobut-1-enyl]azanium is [H]/N=C(\C=C/[NH2+]CC)C(F)(F)F.
What is the InChIKey of ethyl-[(Z)-4,4,4-trifluoro-3-iminobut-1-enyl]azanium?
The InChIKey is YOURFAFNCQOPQB-DXWLQBKVSA-O. The full InChI is InChI=1S/C6H9F3N2/c1-2-11-4-3-5(10)6(7,8)9/h3-4,10-11H,2H2,1H3/p+1/b4-3-,10-5+.
What are the key properties of ethyl-[(Z)-4,4,4-trifluoro-3-iminobut-1-enyl]azanium?
ethyl-[(Z)-4,4,4-trifluoro-3-iminobut-1-enyl]azanium has a molecular weight of 167.15 g/mol, XLogP of 0.67, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl-[(Z)-4,4,4-trifluoro-3-iminobut-1-enyl]azanium is sourced from PubChem (CID 142308476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).