C33H49N — CID 142308507
4-tert-butyl-N-[(3Z)-6,6-dimethyl-5-methylidenehepta-1,3-dien-2-yl]-N-[(3Z)-6,6,7,7-tetramethyl-5-methylideneocta-1,3-dien-2-yl]aniline (PubChem CID 142308507) has the molecular formula C33H49N and a molecular weight of 459.76 g/mol. Its IUPAC name is 4-tert-butyl-N-[(3Z)-6,6-dimethyl-5-methylidenehepta-1,3-dien-2-yl]-N-[(3Z)-6,6,7,7-tetramethyl-5-methylideneocta-1,3-dien-2-yl]aniline.
| Compound Name | 4-tert-butyl-N-[(3Z)-6,6-dimethyl-5-methylidenehepta-1,3-dien-2-yl]-N-[(3Z)-6,6,7,7-tetramethyl-5-methylideneocta-1,3-dien-2-yl]aniline |
|---|---|
| PubChem CID | 142308507 |
| Molecular Formula | C33H49N |
| Molecular Weight | 459.76 g/mol |
| Exact Mass | 459.39 |
| IUPAC Name | 4-tert-butyl-N-[(3Z)-6,6-dimethyl-5-methylidenehepta-1,3-dien-2-yl]-N-[(3Z)-6,6,7,7-tetramethyl-5-methylideneocta-1,3-dien-2-yl]aniline |
| SMILES | C=C(/C=C\C(=C)C(C)(C)C)N(C(=C)/C=C\C(=C)C(C)(C)C(C)(C)C)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C33H49N/c1-24(30(5,6)7)16-18-26(3)34(29-22-20-28(21-23-29)31(8,9)10)27(4)19-17-25(2)33(14,15)32(11,12)13/h16-23H,1-4H2,5-15H3/b18-16-,19-17- |
| InChIKey | KIRWTXVFLQBOFN-YGGBKCGDSA-N |
| XLogP | 10.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.76 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|