About CID 142308542
CID 142308542 (PubChem CID 142308542) has the molecular formula C64H72BN2O2
and a molecular weight of 912.10 g/mol.
Molecular Properties
| Compound Name | CID 142308542 |
| PubChem CID | 142308542 |
| Molecular Formula | C64H72BN2O2 |
| Molecular Weight | 912.10 g/mol |
| Exact Mass | 911.57 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O[B]c1cc(-c2ccccc2-c2ccc(-c3ccc4c(c3)C(C)(C)C(C)(C)C4(C)C)nc2)cc(-c2ccccc2-c2ccc(-c3ccc4c(c3)C(C)(C)C(C)(C)C4(C)C)nc2)c1 |
| InChI | InChI=1S/C64H72BN2O2/c1-57(2)51-29-25-40(36-53(51)59(5,6)61(57,9)10)55-31-27-42(38-66-55)47-21-17-19-23-49(47)44-33-45(35-46(34-44)65-69-64(15,16)63(13,14)68)50-24-20-18-22-48(50)43-28-32-56(67-39-43)41-26-30-52-54(37-41)60(7,8)62(11,12)58(52,3)4/h17-39,68H,1-16H3 |
| InChIKey | VNWKODKSWBEQLB-UHFFFAOYSA-N |
| XLogP | 15.48 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 69 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 912.10 |
| LogP ≤ 5 | 15.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 142308542 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 142308542?
The IUPAC name of CID 142308542 (CID 142308542) is not available.
What is the SMILES notation for CID 142308542?
The canonical SMILES for CID 142308542 is CC(C)(O)C(C)(C)O[B]c1cc(-c2ccccc2-c2ccc(-c3ccc4c(c3)C(C)(C)C(C)(C)C4(C)C)nc2)cc(-c2ccccc2-c2ccc(-c3ccc4c(c3)C(C)(C)C(C)(C)C4(C)C)nc2)c1.
What is the InChIKey of CID 142308542?
The InChIKey is VNWKODKSWBEQLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C64H72BN2O2/c1-57(2)51-29-25-40(36-53(51)59(5,6)61(57,9)10)55-31-27-42(38-66-55)47-21-17-19-23-49(47)44-33-45(35-46(34-44)65-69-64(15,16)63(13,14)68)50-24-20-18-22-48(50)43-28-32-56(67-39-43)41-26-30-52-54(37-41)60(7,8)62(11,12)58(52,3)4/h17-39,68H,1-16H3.
What are the key properties of CID 142308542?
CID 142308542 has a molecular weight of 912.10 g/mol, XLogP of 15.48, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 142308542 is sourced from PubChem (CID 142308542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).