C9H15FN2 — CID 142308838
(1Z,4E)-N-[[(Z)-ethylideneamino]methyl]-5-fluoro-3-methylpenta-1,4-dien-1-amine (PubChem CID 142308838) has the molecular formula C9H15FN2 and a molecular weight of 170.23 g/mol. Its IUPAC name is (1Z,4E)-N-[[(Z)-ethylideneamino]methyl]-5-fluoro-3-methylpenta-1,4-dien-1-amine.
| Compound Name | (1Z,4E)-N-[[(Z)-ethylideneamino]methyl]-5-fluoro-3-methylpenta-1,4-dien-1-amine |
|---|---|
| PubChem CID | 142308838 |
| Molecular Formula | C9H15FN2 |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | (1Z,4E)-N-[[(Z)-ethylideneamino]methyl]-5-fluoro-3-methylpenta-1,4-dien-1-amine |
| SMILES | C/C=N\CN/C=C\C(C)/C=C/F |
| InChI | InChI=1S/C9H15FN2/c1-3-11-8-12-7-5-9(2)4-6-10/h3-7,9,12H,8H2,1-2H3/b6-4+,7-5-,11-3- |
| InChIKey | RLHSTVUIMAXPIE-HOBFXWFWSA-N |
| XLogP | 2.26 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|