About ethane;1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]pyrrolidin-2-one
ethane;1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]pyrrolidin-2-one (PubChem CID 142308897) has the molecular formula C14H23NO
and a molecular weight of 221.34 g/mol. Its IUPAC name is ethane;1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | ethane;1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]pyrrolidin-2-one |
| PubChem CID | 142308897 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | ethane;1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]pyrrolidin-2-one |
| SMILES | C=C/C(=C\C=C(C)C)N1CCCC1=O.CC |
| InChI | InChI=1S/C12H17NO.C2H6/c1-4-11(8-7-10(2)3)13-9-5-6-12(13)14;1-2/h4,7-8H,1,5-6,9H2,2-3H3;1-2H3/b11-8+; |
| InChIKey | UVQWVRRGCOLUGV-YGCVIUNWSA-N |
| XLogP | 3.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]pyrrolidin-2-one?
The IUPAC name of ethane;1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]pyrrolidin-2-one (CID 142308897) is ethane;1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]pyrrolidin-2-one.
What is the SMILES notation for ethane;1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]pyrrolidin-2-one?
The canonical SMILES for ethane;1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]pyrrolidin-2-one is C=C/C(=C\C=C(C)C)N1CCCC1=O.CC.
What is the InChIKey of ethane;1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]pyrrolidin-2-one?
The InChIKey is UVQWVRRGCOLUGV-YGCVIUNWSA-N. The full InChI is InChI=1S/C12H17NO.C2H6/c1-4-11(8-7-10(2)3)13-9-5-6-12(13)14;1-2/h4,7-8H,1,5-6,9H2,2-3H3;1-2H3/b11-8+;.
What are the key properties of ethane;1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]pyrrolidin-2-one?
ethane;1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]pyrrolidin-2-one has a molecular weight of 221.34 g/mol, XLogP of 3.67, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]pyrrolidin-2-one is sourced from PubChem (CID 142308897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).