C14H24FN — CID 142309003
(2E,4Z,6Z)-N-(2-fluoroethyl)-N-methyl-6-propan-2-ylocta-2,4,6-trien-3-amine (PubChem CID 142309003) has the molecular formula C14H24FN and a molecular weight of 225.35 g/mol. Its IUPAC name is (2E,4Z,6Z)-N-(2-fluoroethyl)-N-methyl-6-propan-2-ylocta-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z,6Z)-N-(2-fluoroethyl)-N-methyl-6-propan-2-ylocta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 142309003 |
| Molecular Formula | C14H24FN |
| Molecular Weight | 225.35 g/mol |
| Exact Mass | 225.19 |
| IUPAC Name | (2E,4Z,6Z)-N-(2-fluoroethyl)-N-methyl-6-propan-2-ylocta-2,4,6-trien-3-amine |
| SMILES | C/C=C(\C=C/C(=C\C)N(C)CCF)C(C)C |
| InChI | InChI=1S/C14H24FN/c1-6-13(12(3)4)8-9-14(7-2)16(5)11-10-15/h6-9,12H,10-11H2,1-5H3/b9-8-,13-6+,14-7+ |
| InChIKey | PRRIVIYTNGQGOG-TZDILNBQSA-N |
| XLogP | 3.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|