About ethane;2-methyl-1H-1,5-diazonine;molecular hydrogen
ethane;2-methyl-1H-1,5-diazonine;molecular hydrogen (PubChem CID 142309149) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is ethane;2-methyl-1H-1,5-diazonine;molecular hydrogen.
Molecular Properties
| Compound Name | ethane;2-methyl-1H-1,5-diazonine;molecular hydrogen |
| PubChem CID | 142309149 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | ethane;2-methyl-1H-1,5-diazonine;molecular hydrogen |
| SMILES | CC.Cc1ccncccc[nH]1.[H][H] |
| InChI | InChI=1S/C8H10N2.C2H6.H2/c1-8-4-7-9-5-2-3-6-10-8;1-2;/h2-7,10H,1H3;1-2H3;1H/b5-2-,6-3-,8-4-,9-7-;; |
| InChIKey | PFTBLQNWAQXDHH-LALQTRPASA-N |
| XLogP | 3.11 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-methyl-1H-1,5-diazonine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-1H-1,5-diazonine;molecular hydrogen?
The IUPAC name of ethane;2-methyl-1H-1,5-diazonine;molecular hydrogen (CID 142309149) is ethane;2-methyl-1H-1,5-diazonine;molecular hydrogen.
What is the SMILES notation for ethane;2-methyl-1H-1,5-diazonine;molecular hydrogen?
The canonical SMILES for ethane;2-methyl-1H-1,5-diazonine;molecular hydrogen is CC.Cc1ccncccc[nH]1.[H][H].
What is the InChIKey of ethane;2-methyl-1H-1,5-diazonine;molecular hydrogen?
The InChIKey is PFTBLQNWAQXDHH-LALQTRPASA-N. The full InChI is InChI=1S/C8H10N2.C2H6.H2/c1-8-4-7-9-5-2-3-6-10-8;1-2;/h2-7,10H,1H3;1-2H3;1H/b5-2-,6-3-,8-4-,9-7-;;.
What are the key properties of ethane;2-methyl-1H-1,5-diazonine;molecular hydrogen?
ethane;2-methyl-1H-1,5-diazonine;molecular hydrogen has a molecular weight of 166.27 g/mol, XLogP of 3.11, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-1H-1,5-diazonine;molecular hydrogen is sourced from PubChem (CID 142309149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).