C12H16F2N2O3S — CID 142309464
1-[[6-(difluoromethyl)-3-pyridinyl]sulfonyl]-3-ethylpyrrolidin-3-ol (PubChem CID 142309464) has the molecular formula C12H16F2N2O3S and a molecular weight of 306.33 g/mol. Its IUPAC name is 1-[[6-(difluoromethyl)-3-pyridinyl]sulfonyl]-3-ethylpyrrolidin-3-ol.
| Compound Name | 1-[[6-(difluoromethyl)-3-pyridinyl]sulfonyl]-3-ethylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 142309464 |
| Molecular Formula | C12H16F2N2O3S |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 1-[[6-(difluoromethyl)-3-pyridinyl]sulfonyl]-3-ethylpyrrolidin-3-ol |
| SMILES | CCC1(O)CCN(S(=O)(=O)c2ccc(C(F)F)nc2)C1 |
| InChI | InChI=1S/C12H16F2N2O3S/c1-2-12(17)5-6-16(8-12)20(18,19)9-3-4-10(11(13)14)15-7-9/h3-4,7,11,17H,2,5-6,8H2,1H3 |
| InChIKey | JGDBOSGWCCXGRW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |