About 1-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-3-(hydroxymethyl)pyrrolidin-3-ol
1-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-3-(hydroxymethyl)pyrrolidin-3-ol (PubChem CID 142309567) has the molecular formula C10H12ClN3O4S2
and a molecular weight of 337.81 g/mol. Its IUPAC name is 1-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-3-(hydroxymethyl)pyrrolidin-3-ol.
Molecular Properties
| Compound Name | 1-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-3-(hydroxymethyl)pyrrolidin-3-ol |
| PubChem CID | 142309567 |
| Molecular Formula | C10H12ClN3O4S2 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | 1-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-3-(hydroxymethyl)pyrrolidin-3-ol |
| SMILES | O=S(=O)(c1c(Cl)nc2sccn12)N1CCC(O)(CO)C1 |
| InChI | InChI=1S/C10H12ClN3O4S2/c11-7-8(14-3-4-19-9(14)12-7)20(17,18)13-2-1-10(16,5-13)6-15/h3-4,15-16H,1-2,5-6H2 |
| InChIKey | PIQBTHHMNLERHV-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-3-(hydroxymethyl)pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-3-(hydroxymethyl)pyrrolidin-3-ol?
The IUPAC name of 1-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-3-(hydroxymethyl)pyrrolidin-3-ol (CID 142309567) is 1-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-3-(hydroxymethyl)pyrrolidin-3-ol.
What is the SMILES notation for 1-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-3-(hydroxymethyl)pyrrolidin-3-ol?
The canonical SMILES for 1-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-3-(hydroxymethyl)pyrrolidin-3-ol is O=S(=O)(c1c(Cl)nc2sccn12)N1CCC(O)(CO)C1.
What is the InChIKey of 1-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-3-(hydroxymethyl)pyrrolidin-3-ol?
The InChIKey is PIQBTHHMNLERHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClN3O4S2/c11-7-8(14-3-4-19-9(14)12-7)20(17,18)13-2-1-10(16,5-13)6-15/h3-4,15-16H,1-2,5-6H2.
What are the key properties of 1-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-3-(hydroxymethyl)pyrrolidin-3-ol?
1-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-3-(hydroxymethyl)pyrrolidin-3-ol has a molecular weight of 337.81 g/mol, XLogP of 0.17, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-3-(hydroxymethyl)pyrrolidin-3-ol is sourced from PubChem (CID 142309567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).