About 4-chlorobenzenethiol;3-(hydroxymethyl)pyrrolidin-3-ol
4-chlorobenzenethiol;3-(hydroxymethyl)pyrrolidin-3-ol (PubChem CID 142309719) has the molecular formula C11H16ClNO2S
and a molecular weight of 261.77 g/mol. Its IUPAC name is 4-chlorobenzenethiol;3-(hydroxymethyl)pyrrolidin-3-ol.
Molecular Properties
| Compound Name | 4-chlorobenzenethiol;3-(hydroxymethyl)pyrrolidin-3-ol |
| PubChem CID | 142309719 |
| Molecular Formula | C11H16ClNO2S |
| Molecular Weight | 261.77 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 4-chlorobenzenethiol;3-(hydroxymethyl)pyrrolidin-3-ol |
| SMILES | OCC1(O)CCNC1.Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C6H5ClS.C5H11NO2/c7-5-1-3-6(8)4-2-5;7-4-5(8)1-2-6-3-5/h1-4,8H;6-8H,1-4H2 |
| InChIKey | OZDGWEXCFSWZAA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.77 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-chlorobenzenethiol;3-(hydroxymethyl)pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorobenzenethiol;3-(hydroxymethyl)pyrrolidin-3-ol?
The IUPAC name of 4-chlorobenzenethiol;3-(hydroxymethyl)pyrrolidin-3-ol (CID 142309719) is 4-chlorobenzenethiol;3-(hydroxymethyl)pyrrolidin-3-ol.
What is the SMILES notation for 4-chlorobenzenethiol;3-(hydroxymethyl)pyrrolidin-3-ol?
The canonical SMILES for 4-chlorobenzenethiol;3-(hydroxymethyl)pyrrolidin-3-ol is OCC1(O)CCNC1.Sc1ccc(Cl)cc1.
What is the InChIKey of 4-chlorobenzenethiol;3-(hydroxymethyl)pyrrolidin-3-ol?
The InChIKey is OZDGWEXCFSWZAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClS.C5H11NO2/c7-5-1-3-6(8)4-2-5;7-4-5(8)1-2-6-3-5/h1-4,8H;6-8H,1-4H2.
What are the key properties of 4-chlorobenzenethiol;3-(hydroxymethyl)pyrrolidin-3-ol?
4-chlorobenzenethiol;3-(hydroxymethyl)pyrrolidin-3-ol has a molecular weight of 261.77 g/mol, XLogP of 1.33, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorobenzenethiol;3-(hydroxymethyl)pyrrolidin-3-ol is sourced from PubChem (CID 142309719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).