C25H26O11 — CID 142309856
[(3R)-5,7-dimethoxy-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate;2-methoxybenzene-1,3-diol (PubChem CID 142309856) has the molecular formula C25H26O11 and a molecular weight of 502.47 g/mol. Its IUPAC name is [(3R)-5,7-dimethoxy-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate;2-methoxybenzene-1,3-diol.
| Compound Name | [(3R)-5,7-dimethoxy-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate;2-methoxybenzene-1,3-diol |
|---|---|
| PubChem CID | 142309856 |
| Molecular Formula | C25H26O11 |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | [(3R)-5,7-dimethoxy-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate;2-methoxybenzene-1,3-diol |
| SMILES | COc1c(O)cccc1O.COc1cc(OC)c2c(c1)OC[C@H](OC(=O)c1cc(O)c(O)c(O)c1)C2 |
| InChI | InChI=1S/C18H18O8.C7H8O3/c1-23-10-6-15(24-2)12-5-11(8-25-16(12)7-10)26-18(22)9-3-13(19)17(21)14(20)4-9;1-10-7-5(8)3-2-4-6(7)9/h3-4,6-7,11,19-21H,5,8H2,1-2H3;2-4,8-9H,1H3/t11-;/m1./s1 |
| InChIKey | ROPLODHXLTWGCC-RFVHGSKJSA-N |
| XLogP | 3.09 |
| TPSA | 164.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|