C38H64N2O — CID 142310743
1-[4-tert-butyl-2-(4,4-dimethylcyclohexyl)-5-[1-(propylamino)ethyl]-2,5-dihydro-1H-cyclopenta[b]pyridin-6-yl]propan-1-one;2,3,6-trimethylhepta-1,6-diene (PubChem CID 142310743) has the molecular formula C38H64N2O and a molecular weight of 564.94 g/mol. Its IUPAC name is 1-[4-tert-butyl-2-(4,4-dimethylcyclohexyl)-5-[1-(propylamino)ethyl]-2,5-dihydro-1H-cyclopenta[b]pyridin-6-yl]propan-1-one;2,3,6-trimethylhepta-1,6-diene.
| Compound Name | 1-[4-tert-butyl-2-(4,4-dimethylcyclohexyl)-5-[1-(propylamino)ethyl]-2,5-dihydro-1H-cyclopenta[b]pyridin-6-yl]propan-1-one;2,3,6-trimethylhepta-1,6-diene |
|---|---|
| PubChem CID | 142310743 |
| Molecular Formula | C38H64N2O |
| Molecular Weight | 564.94 g/mol |
| Exact Mass | 564.50 |
| IUPAC Name | 1-[4-tert-butyl-2-(4,4-dimethylcyclohexyl)-5-[1-(propylamino)ethyl]-2,5-dihydro-1H-cyclopenta[b]pyridin-6-yl]propan-1-one;2,3,6-trimethylhepta-1,6-diene |
| SMILES | C=C(C)CCC(C)C(=C)C.CCCNC(C)C1C(C(=O)CC)=CC2=C1C(C(C)(C)C)=CC(C1CCC(C)(C)CC1)N2 |
| InChI | InChI=1S/C28H46N2O.C10H18/c1-9-15-29-18(3)25-20(24(31)10-2)16-23-26(25)21(27(4,5)6)17-22(30-23)19-11-13-28(7,8)14-12-19;1-8(2)6-7-10(5)9(3)4/h16-19,22,25,29-30H,9-15H2,1-8H3;10H,1,3,6-7H2,2,4-5H3 |
| InChIKey | SJQLHIRYBABPBC-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.94 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|