About 1-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperidine-4-thione
1-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperidine-4-thione (PubChem CID 14231098) has the molecular formula C15H18N4O2S
and a molecular weight of 318.40 g/mol. Its IUPAC name is 1-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperidine-4-thione.
Molecular Properties
| Compound Name | 1-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperidine-4-thione |
| PubChem CID | 14231098 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 1-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperidine-4-thione |
| SMILES | COc1cc2nc(N3CCC(=S)CC3)nc(N)c2cc1OC |
| InChI | InChI=1S/C15H18N4O2S/c1-20-12-7-10-11(8-13(12)21-2)17-15(18-14(10)16)19-5-3-9(22)4-6-19/h7-8H,3-6H2,1-2H3,(H2,16,17,18) |
| InChIKey | IIWCRJHKNLQTRZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperidine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperidine-4-thione?
The IUPAC name of 1-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperidine-4-thione (CID 14231098) is 1-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperidine-4-thione.
What is the SMILES notation for 1-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperidine-4-thione?
The canonical SMILES for 1-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperidine-4-thione is COc1cc2nc(N3CCC(=S)CC3)nc(N)c2cc1OC.
What is the InChIKey of 1-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperidine-4-thione?
The InChIKey is IIWCRJHKNLQTRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4O2S/c1-20-12-7-10-11(8-13(12)21-2)17-15(18-14(10)16)19-5-3-9(22)4-6-19/h7-8H,3-6H2,1-2H3,(H2,16,17,18).
What are the key properties of 1-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperidine-4-thione?
1-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperidine-4-thione has a molecular weight of 318.40 g/mol, XLogP of 2.20, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperidine-4-thione is sourced from PubChem (CID 14231098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).