C21H15ClN4O4 — CID 1423115
N-[(7R)-7-(4-chlorophenyl)-5-oxo-7,8-dihydro-6H-quinazolin-2-yl]-4-nitrobenzamide (PubChem CID 1423115) has the molecular formula C21H15ClN4O4 and a molecular weight of 422.83 g/mol. Its IUPAC name is N-[(7R)-7-(4-chlorophenyl)-5-oxo-7,8-dihydro-6H-quinazolin-2-yl]-4-nitrobenzamide.
| Compound Name | N-[(7R)-7-(4-chlorophenyl)-5-oxo-7,8-dihydro-6H-quinazolin-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 1423115 |
| Molecular Formula | C21H15ClN4O4 |
| Molecular Weight | 422.83 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | N-[(7R)-7-(4-chlorophenyl)-5-oxo-7,8-dihydro-6H-quinazolin-2-yl]-4-nitrobenzamide |
| SMILES | O=C(Nc1ncc2c(n1)C[C@@H](c1ccc(Cl)cc1)CC2=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H15ClN4O4/c22-15-5-1-12(2-6-15)14-9-18-17(19(27)10-14)11-23-21(24-18)25-20(28)13-3-7-16(8-4-13)26(29)30/h1-8,11,14H,9-10H2,(H,23,24,25,28)/t14-/m1/s1 |
| InChIKey | LSROVNQGDVRQPQ-CQSZACIVSA-N |
| XLogP | 4.20 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.83 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|