C23H23ClN7O+ — CID 142311530
[[amino-[1-(8-chloroquinolin-4-yl)-2-methyl-6-morpholin-4-ylbenzimidazol-4-yl]methylidene]amino]methylideneazanium (PubChem CID 142311530) has the molecular formula C23H23ClN7O+ and a molecular weight of 448.94 g/mol. Its IUPAC name is [[amino-[1-(8-chloroquinolin-4-yl)-2-methyl-6-morpholin-4-ylbenzimidazol-4-yl]methylidene]amino]methylideneazanium.
| Compound Name | [[amino-[1-(8-chloroquinolin-4-yl)-2-methyl-6-morpholin-4-ylbenzimidazol-4-yl]methylidene]amino]methylideneazanium |
|---|---|
| PubChem CID | 142311530 |
| Molecular Formula | C23H23ClN7O+ |
| Molecular Weight | 448.94 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | [[amino-[1-(8-chloroquinolin-4-yl)-2-methyl-6-morpholin-4-ylbenzimidazol-4-yl]methylidene]amino]methylideneazanium |
| SMILES | Cc1nc2c(/C(N)=N/C=[NH2+])cc(N3CCOCC3)cc2n1-c1ccnc2c(Cl)cccc12 |
| InChI | InChI=1S/C23H22ClN7O/c1-14-29-22-17(23(26)28-13-25)11-15(30-7-9-32-10-8-30)12-20(22)31(14)19-5-6-27-21-16(19)3-2-4-18(21)24/h2-6,11-13H,7-10H2,1H3,(H3,25,26,28)/p+1 |
| InChIKey | IVMLJJHIDXKADU-UHFFFAOYSA-O |
| XLogP | 1.86 |
| TPSA | 107.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.94 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|