About ethane;methyl carbamate;1-pent-1-en-2-ylpyrrolidine
ethane;methyl carbamate;1-pent-1-en-2-ylpyrrolidine (PubChem CID 142311750) has the molecular formula C13H28N2O2
and a molecular weight of 244.38 g/mol. Its IUPAC name is ethane;methyl carbamate;1-pent-1-en-2-ylpyrrolidine.
Molecular Properties
| Compound Name | ethane;methyl carbamate;1-pent-1-en-2-ylpyrrolidine |
| PubChem CID | 142311750 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | ethane;methyl carbamate;1-pent-1-en-2-ylpyrrolidine |
| SMILES | C=C(CCC)N1CCCC1.CC.COC(N)=O |
| InChI | InChI=1S/C9H17N.C2H5NO2.C2H6/c1-3-6-9(2)10-7-4-5-8-10;1-5-2(3)4;1-2/h2-8H2,1H3;1H3,(H2,3,4);1-2H3 |
| InChIKey | YWXDIDWGADWKTI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;methyl carbamate;1-pent-1-en-2-ylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl carbamate;1-pent-1-en-2-ylpyrrolidine?
The IUPAC name of ethane;methyl carbamate;1-pent-1-en-2-ylpyrrolidine (CID 142311750) is ethane;methyl carbamate;1-pent-1-en-2-ylpyrrolidine.
What is the SMILES notation for ethane;methyl carbamate;1-pent-1-en-2-ylpyrrolidine?
The canonical SMILES for ethane;methyl carbamate;1-pent-1-en-2-ylpyrrolidine is C=C(CCC)N1CCCC1.CC.COC(N)=O.
What is the InChIKey of ethane;methyl carbamate;1-pent-1-en-2-ylpyrrolidine?
The InChIKey is YWXDIDWGADWKTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N.C2H5NO2.C2H6/c1-3-6-9(2)10-7-4-5-8-10;1-5-2(3)4;1-2/h2-8H2,1H3;1H3,(H2,3,4);1-2H3.
What are the key properties of ethane;methyl carbamate;1-pent-1-en-2-ylpyrrolidine?
ethane;methyl carbamate;1-pent-1-en-2-ylpyrrolidine has a molecular weight of 244.38 g/mol, XLogP of 3.13, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl carbamate;1-pent-1-en-2-ylpyrrolidine is sourced from PubChem (CID 142311750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).