C27H37F2N3O2 — CID 142311823
1-(3-amino-4-methanimidoyl-2-bicyclo[4.2.0]octa-1,3,5-trienyl)-2,2-difluoro-6-methyl-3-propylheptan-1-ol;1-pyridin-3-ylethanone (PubChem CID 142311823) has the molecular formula C27H37F2N3O2 and a molecular weight of 473.61 g/mol. Its IUPAC name is 1-(3-amino-4-methanimidoyl-2-bicyclo[4.2.0]octa-1,3,5-trienyl)-2,2-difluoro-6-methyl-3-propylheptan-1-ol;1-pyridin-3-ylethanone.
| Compound Name | 1-(3-amino-4-methanimidoyl-2-bicyclo[4.2.0]octa-1,3,5-trienyl)-2,2-difluoro-6-methyl-3-propylheptan-1-ol;1-pyridin-3-ylethanone |
|---|---|
| PubChem CID | 142311823 |
| Molecular Formula | C27H37F2N3O2 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | 1-(3-amino-4-methanimidoyl-2-bicyclo[4.2.0]octa-1,3,5-trienyl)-2,2-difluoro-6-methyl-3-propylheptan-1-ol;1-pyridin-3-ylethanone |
| SMILES | CC(=O)c1cccnc1.[H]/N=C/c1cc2c(c(C(O)C(F)(F)C(CCC)CCC(C)C)c1N)CC2 |
| InChI | InChI=1S/C20H30F2N2O.C7H7NO/c1-4-5-15(8-6-12(2)3)20(21,22)19(25)17-16-9-7-13(16)10-14(11-23)18(17)24;1-6(9)7-3-2-4-8-5-7/h10-12,15,19,23,25H,4-9,24H2,1-3H3;2-5H,1H3/b23-11+; |
| InChIKey | GLSKQTZBDVMAKR-YDLOHEMZSA-N |
| XLogP | 6.17 |
| TPSA | 100.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|