C20H30F2N2O — CID 142311824
1-(3-amino-4-methanimidoyl-2-bicyclo[4.2.0]octa-1,3,5-trienyl)-2,2-difluoro-6-methyl-3-propylheptan-1-ol (PubChem CID 142311824) has the molecular formula C20H30F2N2O and a molecular weight of 352.47 g/mol. Its IUPAC name is 1-(3-amino-4-methanimidoyl-2-bicyclo[4.2.0]octa-1,3,5-trienyl)-2,2-difluoro-6-methyl-3-propylheptan-1-ol.
| Compound Name | 1-(3-amino-4-methanimidoyl-2-bicyclo[4.2.0]octa-1,3,5-trienyl)-2,2-difluoro-6-methyl-3-propylheptan-1-ol |
|---|---|
| PubChem CID | 142311824 |
| Molecular Formula | C20H30F2N2O |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 1-(3-amino-4-methanimidoyl-2-bicyclo[4.2.0]octa-1,3,5-trienyl)-2,2-difluoro-6-methyl-3-propylheptan-1-ol |
| SMILES | [H]/N=C/c1cc2c(c(C(O)C(F)(F)C(CCC)CCC(C)C)c1N)CC2 |
| InChI | InChI=1S/C20H30F2N2O/c1-4-5-15(8-6-12(2)3)20(21,22)19(25)17-16-9-7-13(16)10-14(11-23)18(17)24/h10-12,15,19,23,25H,4-9,24H2,1-3H3/b23-11+ |
| InChIKey | VAKJZVFVYORAAK-FOKLQQMPSA-N |
| XLogP | 4.89 |
| TPSA | 70.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|