C17H22ClF2N3O3S — CID 142311953
N-[(2S)-2-[(2R)-4-(5-chloro-1H-indazol-7-yl)-3,3-difluoro-4-hydroxybutan-2-yl]pent-4-enyl]methanesulfonamide (PubChem CID 142311953) has the molecular formula C17H22ClF2N3O3S and a molecular weight of 421.90 g/mol. Its IUPAC name is N-[(2S)-2-[(2R)-4-(5-chloro-1H-indazol-7-yl)-3,3-difluoro-4-hydroxybutan-2-yl]pent-4-enyl]methanesulfonamide.
| Compound Name | N-[(2S)-2-[(2R)-4-(5-chloro-1H-indazol-7-yl)-3,3-difluoro-4-hydroxybutan-2-yl]pent-4-enyl]methanesulfonamide |
|---|---|
| PubChem CID | 142311953 |
| Molecular Formula | C17H22ClF2N3O3S |
| Molecular Weight | 421.90 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | N-[(2S)-2-[(2R)-4-(5-chloro-1H-indazol-7-yl)-3,3-difluoro-4-hydroxybutan-2-yl]pent-4-enyl]methanesulfonamide |
| SMILES | C=CC[C@H](CNS(C)(=O)=O)[C@@H](C)C(F)(F)C(O)c1cc(Cl)cc2cn[nH]c12 |
| InChI | InChI=1S/C17H22ClF2N3O3S/c1-4-5-11(9-22-27(3,25)26)10(2)17(19,20)16(24)14-7-13(18)6-12-8-21-23-15(12)14/h4,6-8,10-11,16,22,24H,1,5,9H2,2-3H3,(H,21,23)/t10-,11-,16?/m1/s1 |
| InChIKey | GFVILJMMNNLQRI-FBOURYKNSA-N |
| XLogP | 3.26 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.90 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|