About 1-(3,3-difluoro-1-methylcyclobutyl)-1,1-difluoropropan-2-ol;ethane
1-(3,3-difluoro-1-methylcyclobutyl)-1,1-difluoropropan-2-ol;ethane (PubChem CID 142312006) has the molecular formula C10H18F4O
and a molecular weight of 230.24 g/mol. Its IUPAC name is 1-(3,3-difluoro-1-methylcyclobutyl)-1,1-difluoropropan-2-ol;ethane.
Molecular Properties
| Compound Name | 1-(3,3-difluoro-1-methylcyclobutyl)-1,1-difluoropropan-2-ol;ethane |
| PubChem CID | 142312006 |
| Molecular Formula | C10H18F4O |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 1-(3,3-difluoro-1-methylcyclobutyl)-1,1-difluoropropan-2-ol;ethane |
| SMILES | CC.CC(O)C(F)(F)C1(C)CC(F)(F)C1 |
| InChI | InChI=1S/C8H12F4O.C2H6/c1-5(13)8(11,12)6(2)3-7(9,10)4-6;1-2/h5,13H,3-4H2,1-2H3;1-2H3 |
| InChIKey | MSEIUTYJXNNRTP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3,3-difluoro-1-methylcyclobutyl)-1,1-difluoropropan-2-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-difluoro-1-methylcyclobutyl)-1,1-difluoropropan-2-ol;ethane?
The IUPAC name of 1-(3,3-difluoro-1-methylcyclobutyl)-1,1-difluoropropan-2-ol;ethane (CID 142312006) is 1-(3,3-difluoro-1-methylcyclobutyl)-1,1-difluoropropan-2-ol;ethane.
What is the SMILES notation for 1-(3,3-difluoro-1-methylcyclobutyl)-1,1-difluoropropan-2-ol;ethane?
The canonical SMILES for 1-(3,3-difluoro-1-methylcyclobutyl)-1,1-difluoropropan-2-ol;ethane is CC.CC(O)C(F)(F)C1(C)CC(F)(F)C1.
What is the InChIKey of 1-(3,3-difluoro-1-methylcyclobutyl)-1,1-difluoropropan-2-ol;ethane?
The InChIKey is MSEIUTYJXNNRTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F4O.C2H6/c1-5(13)8(11,12)6(2)3-7(9,10)4-6;1-2/h5,13H,3-4H2,1-2H3;1-2H3.
What are the key properties of 1-(3,3-difluoro-1-methylcyclobutyl)-1,1-difluoropropan-2-ol;ethane?
1-(3,3-difluoro-1-methylcyclobutyl)-1,1-difluoropropan-2-ol;ethane has a molecular weight of 230.24 g/mol, XLogP of 3.46, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-difluoro-1-methylcyclobutyl)-1,1-difluoropropan-2-ol;ethane is sourced from PubChem (CID 142312006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).