About 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide
2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide (PubChem CID 142312092) has the molecular formula C12H21N5O2S
and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide.
Molecular Properties
| Compound Name | 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide |
| PubChem CID | 142312092 |
| Molecular Formula | C12H21N5O2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide |
| SMILES | CN1CCN(CCNC(=O)CC2SC(N)=NC2=O)CC1 |
| InChI | InChI=1S/C12H21N5O2S/c1-16-4-6-17(7-5-16)3-2-14-10(18)8-9-11(19)15-12(13)20-9/h9H,2-8H2,1H3,(H,14,18)(H2,13,15,19) |
| InChIKey | XPDPRCSPRMBEQS-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide?
The IUPAC name of 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide (CID 142312092) is 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide.
What is the SMILES notation for 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide?
The canonical SMILES for 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide is CN1CCN(CCNC(=O)CC2SC(N)=NC2=O)CC1.
What is the InChIKey of 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide?
The InChIKey is XPDPRCSPRMBEQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N5O2S/c1-16-4-6-17(7-5-16)3-2-14-10(18)8-9-11(19)15-12(13)20-9/h9H,2-8H2,1H3,(H,14,18)(H2,13,15,19).
What are the key properties of 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide?
2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide has a molecular weight of 299.40 g/mol, XLogP of -1.30, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide is sourced from PubChem (CID 142312092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).