C24H28N3O8P — CID 142312426
[5-[2,4-dioxo-3-[(5-phenyl-2-pyridinyl)methyl]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphite;prop-1-ene (PubChem CID 142312426) has the molecular formula C24H28N3O8P and a molecular weight of 517.48 g/mol. Its IUPAC name is [5-[2,4-dioxo-3-[(5-phenyl-2-pyridinyl)methyl]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphite;prop-1-ene.
| Compound Name | [5-[2,4-dioxo-3-[(5-phenyl-2-pyridinyl)methyl]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphite;prop-1-ene |
|---|---|
| PubChem CID | 142312426 |
| Molecular Formula | C24H28N3O8P |
| Molecular Weight | 517.48 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | [5-[2,4-dioxo-3-[(5-phenyl-2-pyridinyl)methyl]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphite;prop-1-ene |
| SMILES | C=CC.O=c1ccn(C2OC(COP(O)O)C(O)C2O)c(=O)n1Cc1ccc(-c2ccccc2)cn1 |
| InChI | InChI=1S/C21H22N3O8P.C3H6/c25-17-8-9-23(20-19(27)18(26)16(32-20)12-31-33(29)30)21(28)24(17)11-15-7-6-14(10-22-15)13-4-2-1-3-5-13;1-3-2/h1-10,16,18-20,26-27,29-30H,11-12H2;3H,1H2,2H3 |
| InChIKey | QCMSXECJFKYJLY-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 156.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.48 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|