C28H31F2N3O5 — CID 142312855
6-[(3aR)-5-[[5-cyclopropyl-3-[2-(difluoromethoxy)phenyl]-1,2-oxazol-4-yl]methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]pyridine-3-carbaldehyde;methanol (PubChem CID 142312855) has the molecular formula C28H31F2N3O5 and a molecular weight of 527.57 g/mol. Its IUPAC name is 6-[(3aR)-5-[[5-cyclopropyl-3-[2-(difluoromethoxy)phenyl]-1,2-oxazol-4-yl]methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]pyridine-3-carbaldehyde;methanol.
| Compound Name | 6-[(3aR)-5-[[5-cyclopropyl-3-[2-(difluoromethoxy)phenyl]-1,2-oxazol-4-yl]methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]pyridine-3-carbaldehyde;methanol |
|---|---|
| PubChem CID | 142312855 |
| Molecular Formula | C28H31F2N3O5 |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | 6-[(3aR)-5-[[5-cyclopropyl-3-[2-(difluoromethoxy)phenyl]-1,2-oxazol-4-yl]methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]pyridine-3-carbaldehyde;methanol |
| SMILES | CO.O=Cc1ccc(N2CC3CC(OCc4c(-c5ccccc5OC(F)F)noc4C4CC4)C[C@H]3C2)nc1 |
| InChI | InChI=1S/C27H27F2N3O4.CH4O/c28-27(29)35-23-4-2-1-3-21(23)25-22(26(36-31-25)17-6-7-17)15-34-20-9-18-12-32(13-19(18)10-20)24-8-5-16(14-33)11-30-24;1-2/h1-5,8,11,14,17-20,27H,6-7,9-10,12-13,15H2;2H,1H3/t18-,19?,20?;/m0./s1 |
| InChIKey | ZNPFMUZHBXJYMZ-ZBMFEAOPSA-N |
| XLogP | 5.07 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|