C32H45N3O4S — CID 142313414
tert-butyl 3-[2-[3-[2-[4-(3a,7a-dihydro-1,2-benzothiazol-3-yl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]ethyl]phenyl]ethoxy]propanoate (PubChem CID 142313414) has the molecular formula C32H45N3O4S and a molecular weight of 567.80 g/mol. Its IUPAC name is tert-butyl 3-[2-[3-[2-[4-(3a,7a-dihydro-1,2-benzothiazol-3-yl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]ethyl]phenyl]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[3-[2-[4-(3a,7a-dihydro-1,2-benzothiazol-3-yl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]ethyl]phenyl]ethoxy]propanoate |
|---|---|
| PubChem CID | 142313414 |
| Molecular Formula | C32H45N3O4S |
| Molecular Weight | 567.80 g/mol |
| Exact Mass | 567.31 |
| IUPAC Name | tert-butyl 3-[2-[3-[2-[4-(3a,7a-dihydro-1,2-benzothiazol-3-yl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]ethyl]phenyl]ethoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCCc1cccc(CCN2CCC3(CC2)CN(C2=NSC4C=CC=CC24)CCO3)c1 |
| InChI | InChI=1S/C32H45N3O4S/c1-31(2,3)39-29(36)13-21-37-20-12-26-8-6-7-25(23-26)11-16-34-17-14-32(15-18-34)24-35(19-22-38-32)30-27-9-4-5-10-28(27)40-33-30/h4-10,23,27-28H,11-22,24H2,1-3H3 |
| InChIKey | WEUBJEGWBZRLDF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.80 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|