C32H53N5O5 — CID 142313566
N-butyl-N-(2,2-dimethoxyethyl)-3-[2-[3-[2-(4-prop-2-enehydrazonoyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]propanamide (PubChem CID 142313566) has the molecular formula C32H53N5O5 and a molecular weight of 587.81 g/mol. Its IUPAC name is N-butyl-N-(2,2-dimethoxyethyl)-3-[2-[3-[2-(4-prop-2-enehydrazonoyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]propanamide.
| Compound Name | N-butyl-N-(2,2-dimethoxyethyl)-3-[2-[3-[2-(4-prop-2-enehydrazonoyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]propanamide |
|---|---|
| PubChem CID | 142313566 |
| Molecular Formula | C32H53N5O5 |
| Molecular Weight | 587.81 g/mol |
| Exact Mass | 587.40 |
| IUPAC Name | N-butyl-N-(2,2-dimethoxyethyl)-3-[2-[3-[2-(4-prop-2-enehydrazonoyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]propanamide |
| SMILES | C=C/C(=N\N)N1CCOC2(CCN(CCc3cccc(CCOCCC(=O)N(CCCC)CC(OC)OC)c3)CC2)C1 |
| InChI | InChI=1S/C32H53N5O5/c1-5-7-16-36(25-31(39-3)40-4)30(38)13-22-41-21-12-28-10-8-9-27(24-28)11-17-35-18-14-32(15-19-35)26-37(20-23-42-32)29(6-2)34-33/h6,8-10,24,31H,2,5,7,11-23,25-26,33H2,1,3-4H3/b34-29+ |
| InChIKey | ONZUYFLWNXTYHW-RIHQVDFKSA-N |
| XLogP | 3.05 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.81 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|