C27H41N3O3 — CID 142313575
3-[2-[3-[[4-methyl-4-[[[(2Z,4E)-5-(propylamino)penta-2,4-dienylidene]amino]methyl]piperidin-1-yl]methyl]phenyl]ethoxy]propanoic acid (PubChem CID 142313575) has the molecular formula C27H41N3O3 and a molecular weight of 455.64 g/mol. Its IUPAC name is 3-[2-[3-[[4-methyl-4-[[[(2Z,4E)-5-(propylamino)penta-2,4-dienylidene]amino]methyl]piperidin-1-yl]methyl]phenyl]ethoxy]propanoic acid.
| Compound Name | 3-[2-[3-[[4-methyl-4-[[[(2Z,4E)-5-(propylamino)penta-2,4-dienylidene]amino]methyl]piperidin-1-yl]methyl]phenyl]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 142313575 |
| Molecular Formula | C27H41N3O3 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.31 |
| IUPAC Name | 3-[2-[3-[[4-methyl-4-[[[(2Z,4E)-5-(propylamino)penta-2,4-dienylidene]amino]methyl]piperidin-1-yl]methyl]phenyl]ethoxy]propanoic acid |
| SMILES | CCCN/C=C/C=C\C=N\CC1(C)CCN(Cc2cccc(CCOCCC(=O)O)c2)CC1 |
| InChI | InChI=1S/C27H41N3O3/c1-3-14-28-15-5-4-6-16-29-23-27(2)12-17-30(18-13-27)22-25-9-7-8-24(21-25)10-19-33-20-11-26(31)32/h4-9,15-16,21,28H,3,10-14,17-20,22-23H2,1-2H3,(H,31,32)/b6-4-,15-5+,29-16+ |
| InChIKey | GJXISIHRFUWCFV-CJXKPVTMSA-N |
| XLogP | 4.46 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|