About 3-[2-[3-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]propanoic acid
3-[2-[3-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]propanoic acid (PubChem CID 142313625) has the molecular formula C21H32N2O4
and a molecular weight of 376.50 g/mol. Its IUPAC name is 3-[2-[3-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]propanoic acid.
Molecular Properties
| Compound Name | 3-[2-[3-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]propanoic acid |
| PubChem CID | 142313625 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 3-[2-[3-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]propanoic acid |
| SMILES | O=C(O)CCOCCc1cccc(CCN2CCC3(CC2)CNCCO3)c1 |
| InChI | InChI=1S/C21H32N2O4/c24-20(25)6-14-26-13-5-19-3-1-2-18(16-19)4-10-23-11-7-21(8-12-23)17-22-9-15-27-21/h1-3,16,22H,4-15,17H2,(H,24,25) |
| InChIKey | AOBYMXWEOJHDMO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[3-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[3-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]propanoic acid?
The IUPAC name of 3-[2-[3-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]propanoic acid (CID 142313625) is 3-[2-[3-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]propanoic acid.
What is the SMILES notation for 3-[2-[3-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]propanoic acid?
The canonical SMILES for 3-[2-[3-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]propanoic acid is O=C(O)CCOCCc1cccc(CCN2CCC3(CC2)CNCCO3)c1.
What is the InChIKey of 3-[2-[3-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]propanoic acid?
The InChIKey is AOBYMXWEOJHDMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32N2O4/c24-20(25)6-14-26-13-5-19-3-1-2-18(16-19)4-10-23-11-7-21(8-12-23)17-22-9-15-27-21/h1-3,16,22H,4-15,17H2,(H,24,25).
What are the key properties of 3-[2-[3-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]propanoic acid?
3-[2-[3-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]propanoic acid has a molecular weight of 376.50 g/mol, XLogP of 1.72, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[3-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]phenyl]ethoxy]propanoic acid is sourced from PubChem (CID 142313625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).