C29H43N3O4 — CID 142313694
tert-butyl 3-[2-[3-[[4-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]methyl]phenyl]ethoxy]propanoate (PubChem CID 142313694) has the molecular formula C29H43N3O4 and a molecular weight of 497.68 g/mol. Its IUPAC name is tert-butyl 3-[2-[3-[[4-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]methyl]phenyl]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[3-[[4-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]methyl]phenyl]ethoxy]propanoate |
|---|---|
| PubChem CID | 142313694 |
| Molecular Formula | C29H43N3O4 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.33 |
| IUPAC Name | tert-butyl 3-[2-[3-[[4-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]methyl]phenyl]ethoxy]propanoate |
| SMILES | C=C/C=C(\N=C)N1CCOC2(CCN(Cc3cccc(CCOCCC(=O)OC(C)(C)C)c3)CC2)C1 |
| InChI | InChI=1S/C29H43N3O4/c1-6-8-26(30-5)32-17-20-35-29(23-32)13-15-31(16-14-29)22-25-10-7-9-24(21-25)11-18-34-19-12-27(33)36-28(2,3)4/h6-10,21H,1,5,11-20,22-23H2,2-4H3/b26-8+ |
| InChIKey | OKUTXUCECHFBPC-MWRNPHMMSA-N |
| XLogP | 4.37 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|