C32H50N4O6 — CID 142313737
N-(2,2-dimethoxyethyl)-N-methyl-3-[2-[3-[2-[4-[(2E,4Z)-5-(methylamino)-1-oxopenta-2,4-dien-2-yl]-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]ethyl]phenyl]ethoxy]propanamide (PubChem CID 142313737) has the molecular formula C32H50N4O6 and a molecular weight of 586.77 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-N-methyl-3-[2-[3-[2-[4-[(2E,4Z)-5-(methylamino)-1-oxopenta-2,4-dien-2-yl]-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]ethyl]phenyl]ethoxy]propanamide.
| Compound Name | N-(2,2-dimethoxyethyl)-N-methyl-3-[2-[3-[2-[4-[(2E,4Z)-5-(methylamino)-1-oxopenta-2,4-dien-2-yl]-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]ethyl]phenyl]ethoxy]propanamide |
|---|---|
| PubChem CID | 142313737 |
| Molecular Formula | C32H50N4O6 |
| Molecular Weight | 586.77 g/mol |
| Exact Mass | 586.37 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-N-methyl-3-[2-[3-[2-[4-[(2E,4Z)-5-(methylamino)-1-oxopenta-2,4-dien-2-yl]-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]ethyl]phenyl]ethoxy]propanamide |
| SMILES | CN/C=C\C=C(/C=O)N1CCOC2(CCN(CCc3cccc(CCOCCC(=O)N(C)CC(OC)OC)c3)CC2)C1 |
| InChI | InChI=1S/C32H50N4O6/c1-33-15-6-9-29(25-37)36-19-22-42-32(26-36)13-17-35(18-14-32)16-10-27-7-5-8-28(23-27)11-20-41-21-12-30(38)34(2)24-31(39-3)40-4/h5-9,15,23,25,31,33H,10-14,16-22,24,26H2,1-4H3/b15-6-,29-9+ |
| InChIKey | JWDLTAQUQUCNMJ-VPJJFAJZSA-N |
| XLogP | 2.24 |
| TPSA | 92.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.77 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|