C30H46N4O5 — CID 142313739
N-(2,2-dimethoxyethyl)-N-methyl-3-[2-[3-[[(11E,13Z)-7-oxa-3,10,16-triazaspiro[5.11]heptadeca-11,13,15-trien-3-yl]methyl]phenyl]ethoxy]propanamide (PubChem CID 142313739) has the molecular formula C30H46N4O5 and a molecular weight of 542.72 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-N-methyl-3-[2-[3-[[(11E,13Z)-7-oxa-3,10,16-triazaspiro[5.11]heptadeca-11,13,15-trien-3-yl]methyl]phenyl]ethoxy]propanamide.
| Compound Name | N-(2,2-dimethoxyethyl)-N-methyl-3-[2-[3-[[(11E,13Z)-7-oxa-3,10,16-triazaspiro[5.11]heptadeca-11,13,15-trien-3-yl]methyl]phenyl]ethoxy]propanamide |
|---|---|
| PubChem CID | 142313739 |
| Molecular Formula | C30H46N4O5 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.35 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-N-methyl-3-[2-[3-[[(11E,13Z)-7-oxa-3,10,16-triazaspiro[5.11]heptadeca-11,13,15-trien-3-yl]methyl]phenyl]ethoxy]propanamide |
| SMILES | COC(CN(C)C(=O)CCOCCc1cccc(CN2CCC3(CC2)C/N=C/C=C\C=C\NCCO3)c1)OC |
| InChI | InChI=1S/C30H46N4O5/c1-33(24-29(36-2)37-3)28(35)11-20-38-19-10-26-8-7-9-27(22-26)23-34-17-12-30(13-18-34)25-32-15-6-4-5-14-31-16-21-39-30/h4-9,14-15,22,29,31H,10-13,16-21,23-25H2,1-3H3/b6-4-,14-5+,32-15+ |
| InChIKey | FAJNWZGMFHTDBD-AVWPIBHJSA-N |
| XLogP | 2.81 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|