About N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-propoxyformamide;ethane;methanethiol
N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-propoxyformamide;ethane;methanethiol (PubChem CID 142314321) has the molecular formula C14H30N2O2S
and a molecular weight of 290.47 g/mol. Its IUPAC name is N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-propoxyformamide;ethane;methanethiol.
Molecular Properties
| Compound Name | N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-propoxyformamide;ethane;methanethiol |
| PubChem CID | 142314321 |
| Molecular Formula | C14H30N2O2S |
| Molecular Weight | 290.47 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-propoxyformamide;ethane;methanethiol |
| SMILES | CC.CCCON(C=O)C1C=C(C)CN(C)C1.CS |
| InChI | InChI=1S/C11H20N2O2.C2H6.CH4S/c1-4-5-15-13(9-14)11-6-10(2)7-12(3)8-11;2*1-2/h6,9,11H,4-5,7-8H2,1-3H3;1-2H3;2H,1H3 |
| InChIKey | YPOXXNLQGMIPLU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 32.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-propoxyformamide;ethane;methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-propoxyformamide;ethane;methanethiol?
The IUPAC name of N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-propoxyformamide;ethane;methanethiol (CID 142314321) is N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-propoxyformamide;ethane;methanethiol.
What is the SMILES notation for N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-propoxyformamide;ethane;methanethiol?
The canonical SMILES for N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-propoxyformamide;ethane;methanethiol is CC.CCCON(C=O)C1C=C(C)CN(C)C1.CS.
What is the InChIKey of N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-propoxyformamide;ethane;methanethiol?
The InChIKey is YPOXXNLQGMIPLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O2.C2H6.CH4S/c1-4-5-15-13(9-14)11-6-10(2)7-12(3)8-11;2*1-2/h6,9,11H,4-5,7-8H2,1-3H3;1-2H3;2H,1H3.
What are the key properties of N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-propoxyformamide;ethane;methanethiol?
N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-propoxyformamide;ethane;methanethiol has a molecular weight of 290.47 g/mol, XLogP of 2.62, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-propoxyformamide;ethane;methanethiol is sourced from PubChem (CID 142314321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).