About 1-(7-oxo-6-propoxy-1,6-diazabicyclo[3.2.1]oct-3-en-3-yl)triazole-4-carboxamide
1-(7-oxo-6-propoxy-1,6-diazabicyclo[3.2.1]oct-3-en-3-yl)triazole-4-carboxamide (PubChem CID 142314344) has the molecular formula C12H16N6O3
and a molecular weight of 292.30 g/mol. Its IUPAC name is 1-(7-oxo-6-propoxy-1,6-diazabicyclo[3.2.1]oct-3-en-3-yl)triazole-4-carboxamide.
Molecular Properties
| Compound Name | 1-(7-oxo-6-propoxy-1,6-diazabicyclo[3.2.1]oct-3-en-3-yl)triazole-4-carboxamide |
| PubChem CID | 142314344 |
| Molecular Formula | C12H16N6O3 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 1-(7-oxo-6-propoxy-1,6-diazabicyclo[3.2.1]oct-3-en-3-yl)triazole-4-carboxamide |
| SMILES | CCCON1C(=O)N2CC(n3cc(C(N)=O)nn3)=CC1C2 |
| InChI | InChI=1S/C12H16N6O3/c1-2-3-21-18-9-4-8(5-16(6-9)12(18)20)17-7-10(11(13)19)14-15-17/h4,7,9H,2-3,5-6H2,1H3,(H2,13,19) |
| InChIKey | LNVDREOKBRCWDS-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 106.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(7-oxo-6-propoxy-1,6-diazabicyclo[3.2.1]oct-3-en-3-yl)triazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-oxo-6-propoxy-1,6-diazabicyclo[3.2.1]oct-3-en-3-yl)triazole-4-carboxamide?
The IUPAC name of 1-(7-oxo-6-propoxy-1,6-diazabicyclo[3.2.1]oct-3-en-3-yl)triazole-4-carboxamide (CID 142314344) is 1-(7-oxo-6-propoxy-1,6-diazabicyclo[3.2.1]oct-3-en-3-yl)triazole-4-carboxamide.
What is the SMILES notation for 1-(7-oxo-6-propoxy-1,6-diazabicyclo[3.2.1]oct-3-en-3-yl)triazole-4-carboxamide?
The canonical SMILES for 1-(7-oxo-6-propoxy-1,6-diazabicyclo[3.2.1]oct-3-en-3-yl)triazole-4-carboxamide is CCCON1C(=O)N2CC(n3cc(C(N)=O)nn3)=CC1C2.
What is the InChIKey of 1-(7-oxo-6-propoxy-1,6-diazabicyclo[3.2.1]oct-3-en-3-yl)triazole-4-carboxamide?
The InChIKey is LNVDREOKBRCWDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N6O3/c1-2-3-21-18-9-4-8(5-16(6-9)12(18)20)17-7-10(11(13)19)14-15-17/h4,7,9H,2-3,5-6H2,1H3,(H2,13,19).
What are the key properties of 1-(7-oxo-6-propoxy-1,6-diazabicyclo[3.2.1]oct-3-en-3-yl)triazole-4-carboxamide?
1-(7-oxo-6-propoxy-1,6-diazabicyclo[3.2.1]oct-3-en-3-yl)triazole-4-carboxamide has a molecular weight of 292.30 g/mol, XLogP of -0.32, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-oxo-6-propoxy-1,6-diazabicyclo[3.2.1]oct-3-en-3-yl)triazole-4-carboxamide is sourced from PubChem (CID 142314344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).