About ethane;N-(1-prop-2-enoxy-3,6-dihydro-2H-pyridin-3-yl)formamide
ethane;N-(1-prop-2-enoxy-3,6-dihydro-2H-pyridin-3-yl)formamide (PubChem CID 142314362) has the molecular formula C13H26N2O2
and a molecular weight of 242.36 g/mol. Its IUPAC name is ethane;N-(1-prop-2-enoxy-3,6-dihydro-2H-pyridin-3-yl)formamide.
Molecular Properties
| Compound Name | ethane;N-(1-prop-2-enoxy-3,6-dihydro-2H-pyridin-3-yl)formamide |
| PubChem CID | 142314362 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | ethane;N-(1-prop-2-enoxy-3,6-dihydro-2H-pyridin-3-yl)formamide |
| SMILES | C=CCON1CC=CC(NC=O)C1.CC.CC |
| InChI | InChI=1S/C9H14N2O2.2C2H6/c1-2-6-13-11-5-3-4-9(7-11)10-8-12;2*1-2/h2-4,8-9H,1,5-7H2,(H,10,12);2*1-2H3 |
| InChIKey | AXIANHYABNIYHZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-(1-prop-2-enoxy-3,6-dihydro-2H-pyridin-3-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(1-prop-2-enoxy-3,6-dihydro-2H-pyridin-3-yl)formamide?
The IUPAC name of ethane;N-(1-prop-2-enoxy-3,6-dihydro-2H-pyridin-3-yl)formamide (CID 142314362) is ethane;N-(1-prop-2-enoxy-3,6-dihydro-2H-pyridin-3-yl)formamide.
What is the SMILES notation for ethane;N-(1-prop-2-enoxy-3,6-dihydro-2H-pyridin-3-yl)formamide?
The canonical SMILES for ethane;N-(1-prop-2-enoxy-3,6-dihydro-2H-pyridin-3-yl)formamide is C=CCON1CC=CC(NC=O)C1.CC.CC.
What is the InChIKey of ethane;N-(1-prop-2-enoxy-3,6-dihydro-2H-pyridin-3-yl)formamide?
The InChIKey is AXIANHYABNIYHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2.2C2H6/c1-2-6-13-11-5-3-4-9(7-11)10-8-12;2*1-2/h2-4,8-9H,1,5-7H2,(H,10,12);2*1-2H3.
What are the key properties of ethane;N-(1-prop-2-enoxy-3,6-dihydro-2H-pyridin-3-yl)formamide?
ethane;N-(1-prop-2-enoxy-3,6-dihydro-2H-pyridin-3-yl)formamide has a molecular weight of 242.36 g/mol, XLogP of 2.14, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(1-prop-2-enoxy-3,6-dihydro-2H-pyridin-3-yl)formamide is sourced from PubChem (CID 142314362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).