About ethyl 2-[3-(4-chloro-3-fluorophenyl)-5-ethyl-1,2,4-triazol-1-yl]acetate
ethyl 2-[3-(4-chloro-3-fluorophenyl)-5-ethyl-1,2,4-triazol-1-yl]acetate (PubChem CID 142314492) has the molecular formula C14H15ClFN3O2
and a molecular weight of 311.74 g/mol. Its IUPAC name is ethyl 2-[3-(4-chloro-3-fluorophenyl)-5-ethyl-1,2,4-triazol-1-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[3-(4-chloro-3-fluorophenyl)-5-ethyl-1,2,4-triazol-1-yl]acetate |
| PubChem CID | 142314492 |
| Molecular Formula | C14H15ClFN3O2 |
| Molecular Weight | 311.74 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | ethyl 2-[3-(4-chloro-3-fluorophenyl)-5-ethyl-1,2,4-triazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1nc(-c2ccc(Cl)c(F)c2)nc1CC |
| InChI | InChI=1S/C14H15ClFN3O2/c1-3-12-17-14(9-5-6-10(15)11(16)7-9)18-19(12)8-13(20)21-4-2/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | FXMUAJKBGLIIJX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.74 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-[3-(4-chloro-3-fluorophenyl)-5-ethyl-1,2,4-triazol-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[3-(4-chloro-3-fluorophenyl)-5-ethyl-1,2,4-triazol-1-yl]acetate?
The IUPAC name of ethyl 2-[3-(4-chloro-3-fluorophenyl)-5-ethyl-1,2,4-triazol-1-yl]acetate (CID 142314492) is ethyl 2-[3-(4-chloro-3-fluorophenyl)-5-ethyl-1,2,4-triazol-1-yl]acetate.
What is the SMILES notation for ethyl 2-[3-(4-chloro-3-fluorophenyl)-5-ethyl-1,2,4-triazol-1-yl]acetate?
The canonical SMILES for ethyl 2-[3-(4-chloro-3-fluorophenyl)-5-ethyl-1,2,4-triazol-1-yl]acetate is CCOC(=O)Cn1nc(-c2ccc(Cl)c(F)c2)nc1CC.
What is the InChIKey of ethyl 2-[3-(4-chloro-3-fluorophenyl)-5-ethyl-1,2,4-triazol-1-yl]acetate?
The InChIKey is FXMUAJKBGLIIJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClFN3O2/c1-3-12-17-14(9-5-6-10(15)11(16)7-9)18-19(12)8-13(20)21-4-2/h5-7H,3-4,8H2,1-2H3.
What are the key properties of ethyl 2-[3-(4-chloro-3-fluorophenyl)-5-ethyl-1,2,4-triazol-1-yl]acetate?
ethyl 2-[3-(4-chloro-3-fluorophenyl)-5-ethyl-1,2,4-triazol-1-yl]acetate has a molecular weight of 311.74 g/mol, XLogP of 2.86, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[3-(4-chloro-3-fluorophenyl)-5-ethyl-1,2,4-triazol-1-yl]acetate is sourced from PubChem (CID 142314492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).