C18H16N6O — CID 142314556
(4aR,7aS)-4-[5-(4-cyano-2-pyridinyl)-2-pyridinyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carbonitrile (PubChem CID 142314556) has the molecular formula C18H16N6O and a molecular weight of 332.37 g/mol. Its IUPAC name is (4aR,7aS)-4-[5-(4-cyano-2-pyridinyl)-2-pyridinyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carbonitrile.
| Compound Name | (4aR,7aS)-4-[5-(4-cyano-2-pyridinyl)-2-pyridinyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carbonitrile |
|---|---|
| PubChem CID | 142314556 |
| Molecular Formula | C18H16N6O |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (4aR,7aS)-4-[5-(4-cyano-2-pyridinyl)-2-pyridinyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carbonitrile |
| SMILES | N#Cc1ccnc(-c2ccc(N3CCO[C@H]4CN(C#N)C[C@H]43)nc2)c1 |
| InChI | InChI=1S/C18H16N6O/c19-8-13-3-4-21-15(7-13)14-1-2-18(22-9-14)24-5-6-25-17-11-23(12-20)10-16(17)24/h1-4,7,9,16-17H,5-6,10-11H2/t16-,17+/m1/s1 |
| InChIKey | QZIQWVCJKAINRT-SJORKVTESA-N |
| XLogP | 1.39 |
| TPSA | 89.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|